C24H15F7N2O4S — CID 18895605
2-[[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895605) has the molecular formula C24H15F7N2O4S and a molecular weight of 560.45 g/mol. Its IUPAC name is 2-[[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895605 |
| Molecular Formula | C24H15F7N2O4S |
| Molecular Weight | 560.45 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | 2-[[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | CC(Sc1cccc(NC(=O)c2ccccc2C(=O)O)c1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C24H15F7N2O4S/c1-10(21(34)33-20-18(27)16(25)15(24(29,30)31)17(26)19(20)28)38-12-6-4-5-11(9-12)32-22(35)13-7-2-3-8-14(13)23(36)37/h2-10H,1H3,(H,32,35)(H,33,34)(H,36,37) |
| InChIKey | OCXPTUXRXTWOHP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.45 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|