C23H13F7N2O4S — CID 18895677
2-[[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18895677) has the molecular formula C23H13F7N2O4S and a molecular weight of 546.42 g/mol. Its IUPAC name is 2-[[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18895677 |
| Molecular Formula | C23H13F7N2O4S |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | 2-[[3-[2-oxo-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | O=C(CSc1cccc(NC(=O)c2ccccc2C(=O)O)c1)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C23H13F7N2O4S/c24-16-15(23(28,29)30)17(25)19(27)20(18(16)26)32-14(33)9-37-11-5-3-4-10(8-11)31-21(34)12-6-1-2-7-13(12)22(35)36/h1-8H,9H2,(H,31,34)(H,32,33)(H,35,36) |
| InChIKey | WUCTVLHFWUABPR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|