C22H17FN2O4S — CID 18903938
4-[[2-[3-[(2-fluorobenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 18903938) has the molecular formula C22H17FN2O4S and a molecular weight of 424.45 g/mol. Its IUPAC name is 4-[[2-[3-[(2-fluorobenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-[(2-fluorobenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18903938 |
| Molecular Formula | C22H17FN2O4S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 4-[[2-[3-[(2-fluorobenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | O=C(CSc1cccc(NC(=O)c2ccccc2F)c1)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H17FN2O4S/c23-19-7-2-1-6-18(19)21(27)25-16-4-3-5-17(12-16)30-13-20(26)24-15-10-8-14(9-11-15)22(28)29/h1-12H,13H2,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | KAWDGVYKYDMNJU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |