C22H19N3O3S2 — CID 19316379
4-[[2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 19316379) has the molecular formula C22H19N3O3S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 4-[[2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 19316379 |
| Molecular Formula | C22H19N3O3S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 4-[[2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | O=C(CSc1cccc(NC(=S)Nc2ccccc2)c1)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H19N3O3S2/c26-20(23-17-11-9-15(10-12-17)21(27)28)14-30-19-8-4-7-18(13-19)25-22(29)24-16-5-2-1-3-6-16/h1-13H,14H2,(H,23,26)(H,27,28)(H2,24,25,29) |
| InChIKey | HRDDMLAWINQQHE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|