C21H18IN3OS2 — CID 19316369
N-(4-iodophenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19316369) has the molecular formula C21H18IN3OS2 and a molecular weight of 519.43 g/mol. Its IUPAC name is N-(4-iodophenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(4-iodophenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19316369 |
| Molecular Formula | C21H18IN3OS2 |
| Molecular Weight | 519.43 g/mol |
| Exact Mass | 518.99 |
| IUPAC Name | N-(4-iodophenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1cccc(NC(=S)Nc2ccccc2)c1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C21H18IN3OS2/c22-15-9-11-17(12-10-15)23-20(26)14-28-19-8-4-7-18(13-19)25-21(27)24-16-5-2-1-3-6-16/h1-13H,14H2,(H,23,26)(H2,24,25,27) |
| InChIKey | UBCGEZZOIWCDOQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|