C22H21N3O2S2 — CID 19712816
N-(3-methoxyphenyl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide (PubChem CID 19712816) has the molecular formula C22H21N3O2S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(3-methoxyphenyl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19712816 |
| Molecular Formula | C22H21N3O2S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[4-(phenylcarbamothioylamino)phenyl]sulfanylacetamide |
| SMILES | COc1cccc(NC(=O)CSc2ccc(NC(=S)Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C22H21N3O2S2/c1-27-19-9-5-8-18(14-19)23-21(26)15-29-20-12-10-17(11-13-20)25-22(28)24-16-6-3-2-4-7-16/h2-14H,15H2,1H3,(H,23,26)(H2,24,25,28) |
| InChIKey | LHWNMBQNRIGOEM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|