C22H20N4O2S2 — CID 19318230
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-pyridin-4-ylacetamide (PubChem CID 19318230) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-pyridin-4-ylacetamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-pyridin-4-ylacetamide |
|---|---|
| PubChem CID | 19318230 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-pyridin-4-ylacetamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SCC(=O)Nc3ccncc3)c2)cc1 |
| InChI | InChI=1S/C22H20N4O2S2/c1-15(27)16-5-7-17(8-6-16)25-22(29)26-19-3-2-4-20(13-19)30-14-21(28)24-18-9-11-23-12-10-18/h2-13H,14H2,1H3,(H,23,24,28)(H2,25,26,29) |
| InChIKey | XUMQPYPCVVDVEI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|