C25H24N2O4S2 — CID 19300127
1-(4-acetylphenyl)-3-[3-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanylphenyl]thiourea (PubChem CID 19300127) has the molecular formula C25H24N2O4S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-[3-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanylphenyl]thiourea.
| Compound Name | 1-(4-acetylphenyl)-3-[3-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanylphenyl]thiourea |
|---|---|
| PubChem CID | 19300127 |
| Molecular Formula | C25H24N2O4S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 1-(4-acetylphenyl)-3-[3-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]sulfanylphenyl]thiourea |
| SMILES | COc1ccc(C(=O)CSc2cccc(NC(=S)Nc3ccc(C(C)=O)cc3)c2)cc1OC |
| InChI | InChI=1S/C25H24N2O4S2/c1-16(28)17-7-10-19(11-8-17)26-25(32)27-20-5-4-6-21(14-20)33-15-22(29)18-9-12-23(30-2)24(13-18)31-3/h4-14H,15H2,1-3H3,(H2,26,27,32) |
| InChIKey | YBCUZHWXEBBUMP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|