C23H22N2O4S — CID 18902730
N-[3-(2-anilino-2-oxoethyl)sulfanylphenyl]-3,4-dimethoxybenzamide (PubChem CID 18902730) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[3-(2-anilino-2-oxoethyl)sulfanylphenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[3-(2-anilino-2-oxoethyl)sulfanylphenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 18902730 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[3-(2-anilino-2-oxoethyl)sulfanylphenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(SCC(=O)Nc3ccccc3)c2)cc1OC |
| InChI | InChI=1S/C23H22N2O4S/c1-28-20-12-11-16(13-21(20)29-2)23(27)25-18-9-6-10-19(14-18)30-15-22(26)24-17-7-4-3-5-8-17/h3-14H,15H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | BOFOPYNBURMCAU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |