C26H28N2O4S — CID 18903647
N-[3-[2-(4-butoxyanilino)-2-oxoethyl]sulfanylphenyl]-4-methoxybenzamide (PubChem CID 18903647) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[3-[2-(4-butoxyanilino)-2-oxoethyl]sulfanylphenyl]-4-methoxybenzamide.
| Compound Name | N-[3-[2-(4-butoxyanilino)-2-oxoethyl]sulfanylphenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 18903647 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[3-[2-(4-butoxyanilino)-2-oxoethyl]sulfanylphenyl]-4-methoxybenzamide |
| SMILES | CCCCOc1ccc(NC(=O)CSc2cccc(NC(=O)c3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C26H28N2O4S/c1-3-4-16-32-23-14-10-20(11-15-23)27-25(29)18-33-24-7-5-6-21(17-24)28-26(30)19-8-12-22(31-2)13-9-19/h5-15,17H,3-4,16,18H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | XSGRHUXRMBJSMM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|