C26H29N3O3S2 — CID 19316952
N-(4-butoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide (PubChem CID 19316952) has the molecular formula C26H29N3O3S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide.
| Compound Name | N-(4-butoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 19316952 |
| Molecular Formula | C26H29N3O3S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-(4-butoxyphenyl)-2-[3-[(2-methoxyphenyl)carbamothioylamino]phenyl]sulfanylacetamide |
| SMILES | CCCCOc1ccc(NC(=O)CSc2cccc(NC(=S)Nc3ccccc3OC)c2)cc1 |
| InChI | InChI=1S/C26H29N3O3S2/c1-3-4-16-32-21-14-12-19(13-15-21)27-25(30)18-34-22-9-7-8-20(17-22)28-26(33)29-23-10-5-6-11-24(23)31-2/h5-15,17H,3-4,16,18H2,1-2H3,(H,27,30)(H2,28,29,33) |
| InChIKey | VHWVYXTXBORKQG-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|