C27H30N2O5S — CID 18907967
N-[3-[2-(4-butoxyanilino)-2-oxoethyl]sulfanylphenyl]-2,6-dimethoxybenzamide (PubChem CID 18907967) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is N-[3-[2-(4-butoxyanilino)-2-oxoethyl]sulfanylphenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[3-[2-(4-butoxyanilino)-2-oxoethyl]sulfanylphenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 18907967 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-[3-[2-(4-butoxyanilino)-2-oxoethyl]sulfanylphenyl]-2,6-dimethoxybenzamide |
| SMILES | CCCCOc1ccc(NC(=O)CSc2cccc(NC(=O)c3c(OC)cccc3OC)c2)cc1 |
| InChI | InChI=1S/C27H30N2O5S/c1-4-5-16-34-21-14-12-19(13-15-21)28-25(30)18-35-22-9-6-8-20(17-22)29-27(31)26-23(32-2)10-7-11-24(26)33-3/h6-15,17H,4-5,16,18H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | MDPFTBSTPBWCSF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|