C27H28N2O5S — CID 18903375
butyl 4-[[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 18903375) has the molecular formula C27H28N2O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is butyl 4-[[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 18903375 |
| Molecular Formula | C27H28N2O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | butyl 4-[[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2cccc(NC(=O)c3cccc(OC)c3)c2)cc1 |
| InChI | InChI=1S/C27H28N2O5S/c1-3-4-15-34-27(32)19-11-13-21(14-12-19)28-25(30)18-35-24-10-6-8-22(17-24)29-26(31)20-7-5-9-23(16-20)33-2/h5-14,16-17H,3-4,15,18H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | GJKHQFLJCRARSA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|