C25H24N2O5S — CID 23095935
ethyl 4-[[2-[4-[(4-methoxybenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 23095935) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is ethyl 4-[[2-[4-[(4-methoxybenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-[(4-methoxybenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 23095935 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | ethyl 4-[[2-[4-[(4-methoxybenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2ccc(NC(=O)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O5S/c1-3-32-25(30)18-4-8-19(9-5-18)26-23(28)16-33-22-14-10-20(11-15-22)27-24(29)17-6-12-21(31-2)13-7-17/h4-15H,3,16H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | HUJAXSUYEQXGGE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |