C25H24N2O4S — CID 22782235
ethyl 4-[[2-[4-[(3-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 22782235) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is ethyl 4-[[2-[4-[(3-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-[(3-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 22782235 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | ethyl 4-[[2-[4-[(3-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSc2ccc(NC(=O)c3cccc(C)c3)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O4S/c1-3-31-25(30)18-7-9-20(10-8-18)26-23(28)16-32-22-13-11-21(12-14-22)27-24(29)19-6-4-5-17(2)15-19/h4-15H,3,16H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | WPJXLOLBOGKVQH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |