C20H21NO5S — CID 19318477
ethyl 4-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanyl-3-oxobutanoate (PubChem CID 19318477) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is ethyl 4-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanyl-3-oxobutanoate.
| Compound Name | ethyl 4-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 19318477 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | ethyl 4-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanyl-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1cccc(NC(=O)c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C20H21NO5S/c1-3-26-19(23)12-16(22)13-27-18-9-5-7-15(11-18)21-20(24)14-6-4-8-17(10-14)25-2/h4-11H,3,12-13H2,1-2H3,(H,21,24) |
| InChIKey | IRYCTXWCZKEUOG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|