C21H18FNO2S — CID 19318774
N-[3-[(2-fluorophenyl)methylsulfanyl]phenyl]-3-methoxybenzamide (PubChem CID 19318774) has the molecular formula C21H18FNO2S and a molecular weight of 367.45 g/mol. Its IUPAC name is N-[3-[(2-fluorophenyl)methylsulfanyl]phenyl]-3-methoxybenzamide.
| Compound Name | N-[3-[(2-fluorophenyl)methylsulfanyl]phenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 19318774 |
| Molecular Formula | C21H18FNO2S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[3-[(2-fluorophenyl)methylsulfanyl]phenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc(SCc3ccccc3F)c2)c1 |
| InChI | InChI=1S/C21H18FNO2S/c1-25-18-9-4-7-15(12-18)21(24)23-17-8-5-10-19(13-17)26-14-16-6-2-3-11-20(16)22/h2-13H,14H2,1H3,(H,23,24) |
| InChIKey | SIMUVIPYAVNJSY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |