C26H30O7S2 — CID 159554035
ethyl 2-(6-methoxy-1-benzothiophen-3-yl)acetate;ethyl 4-(3-methoxyphenyl)sulfanyl-3-oxobutanoate (PubChem CID 159554035) has the molecular formula C26H30O7S2 and a molecular weight of 518.65 g/mol. Its IUPAC name is ethyl 2-(6-methoxy-1-benzothiophen-3-yl)acetate;ethyl 4-(3-methoxyphenyl)sulfanyl-3-oxobutanoate.
| Compound Name | ethyl 2-(6-methoxy-1-benzothiophen-3-yl)acetate;ethyl 4-(3-methoxyphenyl)sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 159554035 |
| Molecular Formula | C26H30O7S2 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | ethyl 2-(6-methoxy-1-benzothiophen-3-yl)acetate;ethyl 4-(3-methoxyphenyl)sulfanyl-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1cccc(OC)c1.CCOC(=O)Cc1csc2cc(OC)ccc12 |
| InChI | InChI=1S/C13H16O4S.C13H14O3S/c1-3-17-13(15)7-10(14)9-18-12-6-4-5-11(8-12)16-2;1-3-16-13(14)6-9-8-17-12-7-10(15-2)4-5-11(9)12/h4-6,8H,3,7,9H2,1-2H3;4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | MFTMUVQSPNLSGU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|