C14H16O4S — CID 131734527
ethyl 2-[6-(1,2-dihydroxyethyl)-1-benzothiophen-3-yl]acetate (PubChem CID 131734527) has the molecular formula C14H16O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is ethyl 2-[6-(1,2-dihydroxyethyl)-1-benzothiophen-3-yl]acetate.
| Compound Name | ethyl 2-[6-(1,2-dihydroxyethyl)-1-benzothiophen-3-yl]acetate |
|---|---|
| PubChem CID | 131734527 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | ethyl 2-[6-(1,2-dihydroxyethyl)-1-benzothiophen-3-yl]acetate |
| SMILES | CCOC(=O)Cc1csc2cc(C(O)CO)ccc12 |
| InChI | InChI=1S/C14H16O4S/c1-2-18-14(17)6-10-8-19-13-5-9(12(16)7-15)3-4-11(10)13/h3-5,8,12,15-16H,2,6-7H2,1H3 |
| InChIKey | PCIAKWRITWTFKM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |