C16H21NO4S — CID 19318471
ethyl 4-[3-(butanoylamino)phenyl]sulfanyl-3-oxobutanoate (PubChem CID 19318471) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is ethyl 4-[3-(butanoylamino)phenyl]sulfanyl-3-oxobutanoate.
| Compound Name | ethyl 4-[3-(butanoylamino)phenyl]sulfanyl-3-oxobutanoate |
|---|---|
| PubChem CID | 19318471 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | ethyl 4-[3-(butanoylamino)phenyl]sulfanyl-3-oxobutanoate |
| SMILES | CCCC(=O)Nc1cccc(SCC(=O)CC(=O)OCC)c1 |
| InChI | InChI=1S/C16H21NO4S/c1-3-6-15(19)17-12-7-5-8-14(9-12)22-11-13(18)10-16(20)21-4-2/h5,7-9H,3-4,6,10-11H2,1-2H3,(H,17,19) |
| InChIKey | PACUBLIOUMCNCY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|