C19H19F3N2O2S — CID 18901579
N-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]butanamide (PubChem CID 18901579) has the molecular formula C19H19F3N2O2S and a molecular weight of 396.43 g/mol. Its IUPAC name is N-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]butanamide.
| Compound Name | N-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]butanamide |
|---|---|
| PubChem CID | 18901579 |
| Molecular Formula | C19H19F3N2O2S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-[3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(SCC(=O)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3N2O2S/c1-2-6-17(25)23-13-7-5-8-14(11-13)27-12-18(26)24-16-10-4-3-9-15(16)19(20,21)22/h3-5,7-11H,2,6,12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | GNBMLMYPQDEFJE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |