C17H16F3NOS — CID 9034330
N-(2-ethylphenyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 9034330) has the molecular formula C17H16F3NOS and a molecular weight of 339.38 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-(2-ethylphenyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 9034330 |
| Molecular Formula | C17H16F3NOS |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-(2-ethylphenyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | CCc1ccccc1NC(=O)CSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F3NOS/c1-2-12-6-3-4-9-15(12)21-16(22)11-23-14-8-5-7-13(10-14)17(18,19)20/h3-10H,2,11H2,1H3,(H,21,22) |
| InChIKey | SIKFBTTWDFBIQD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |