C19H20F3NOS — CID 7484907
N-(2-methyl-6-propan-2-ylphenyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 7484907) has the molecular formula C19H20F3NOS and a molecular weight of 367.44 g/mol. Its IUPAC name is N-(2-methyl-6-propan-2-ylphenyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-(2-methyl-6-propan-2-ylphenyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 7484907 |
| Molecular Formula | C19H20F3NOS |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-(2-methyl-6-propan-2-ylphenyl)-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)CSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3NOS/c1-12(2)16-9-4-6-13(3)18(16)23-17(24)11-25-15-8-5-7-14(10-15)19(20,21)22/h4-10,12H,11H2,1-3H3,(H,23,24) |
| InChIKey | LLXSLAJLGZKBAF-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |