C14H16F3NO3S — CID 119368167
(2R)-3-methyl-2-[[2-[3-(trifluoromethyl)phenyl]sulfanylacetyl]amino]butanoic acid (PubChem CID 119368167) has the molecular formula C14H16F3NO3S and a molecular weight of 335.35 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[2-[3-(trifluoromethyl)phenyl]sulfanylacetyl]amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[2-[3-(trifluoromethyl)phenyl]sulfanylacetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119368167 |
| Molecular Formula | C14H16F3NO3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (2R)-3-methyl-2-[[2-[3-(trifluoromethyl)phenyl]sulfanylacetyl]amino]butanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)CSc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C14H16F3NO3S/c1-8(2)12(13(20)21)18-11(19)7-22-10-5-3-4-9(6-10)14(15,16)17/h3-6,8,12H,7H2,1-2H3,(H,18,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | FVXFRUOYQJZQNP-GFCCVEGCSA-N |
| XLogP | 3.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |