C14H17F3N2O5S — CID 119169773
3-methyl-2-[[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]butanoic acid (PubChem CID 119169773) has the molecular formula C14H17F3N2O5S and a molecular weight of 382.36 g/mol. Its IUPAC name is 3-methyl-2-[[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119169773 |
| Molecular Formula | C14H17F3N2O5S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 3-methyl-2-[[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C14H17F3N2O5S/c1-8(2)12(13(21)22)19-11(20)7-18-25(23,24)10-5-3-4-9(6-10)14(15,16)17/h3-6,8,12,18H,7H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | WECJLEHUNHABLH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |