C15H19F3N2O5S — CID 119954511
2-[butan-2-yl-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]acetic acid (PubChem CID 119954511) has the molecular formula C15H19F3N2O5S and a molecular weight of 396.39 g/mol. Its IUPAC name is 2-[butan-2-yl-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 119954511 |
| Molecular Formula | C15H19F3N2O5S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-[butan-2-yl-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O5S/c1-3-10(2)20(9-14(22)23)13(21)8-19-26(24,25)12-6-4-5-11(7-12)15(16,17)18/h4-7,10,19H,3,8-9H2,1-2H3,(H,22,23) |
| InChIKey | AQURZGVSUDGJCK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |