C16H21F3N2O5S — CID 56548130
tert-butyl 2-[methyl-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]acetate (PubChem CID 56548130) has the molecular formula C16H21F3N2O5S and a molecular weight of 410.41 g/mol. Its IUPAC name is tert-butyl 2-[methyl-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]acetate.
| Compound Name | tert-butyl 2-[methyl-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 56548130 |
| Molecular Formula | C16H21F3N2O5S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | tert-butyl 2-[methyl-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetyl]amino]acetate |
| SMILES | CN(CC(=O)OC(C)(C)C)C(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2O5S/c1-15(2,3)26-14(23)10-21(4)13(22)9-20-27(24,25)12-7-5-6-11(8-12)16(17,18)19/h5-8,20H,9-10H2,1-4H3 |
| InChIKey | FRVNQXIMHUSQED-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |