C22H26F3N3O3S — CID 55416151
N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide (PubChem CID 55416151) has the molecular formula C22H26F3N3O3S and a molecular weight of 469.53 g/mol. Its IUPAC name is N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 55416151 |
| Molecular Formula | C22H26F3N3O3S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | N-methyl-N-[(4-piperidin-1-ylphenyl)methyl]-2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetamide |
| SMILES | CN(Cc1ccc(N2CCCCC2)cc1)C(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H26F3N3O3S/c1-27(16-17-8-10-19(11-9-17)28-12-3-2-4-13-28)21(29)15-26-32(30,31)20-7-5-6-18(14-20)22(23,24)25/h5-11,14,26H,2-4,12-13,15-16H2,1H3 |
| InChIKey | KZEMSPQOBVPZLA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|