C18H21F3N3O2S+ — CID 7202474
N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 7202474) has the molecular formula C18H21F3N3O2S+ and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 7202474 |
| Molecular Formula | C18H21F3N3O2S+ |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | C[NH+]1CCN(c2ccc(NS(=O)(=O)c3cccc(C(F)(F)F)c3)cc2)CC1 |
| InChI | InChI=1S/C18H20F3N3O2S/c1-23-9-11-24(12-10-23)16-7-5-15(6-8-16)22-27(25,26)17-4-2-3-14(13-17)18(19,20)21/h2-8,13,22H,9-12H2,1H3/p+1 |
| InChIKey | LJPCGAFEOFLDDB-UHFFFAOYSA-O |
| XLogP | 1.84 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|