C17H21FN3O2S+ — CID 6927654
4-fluoro-N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]benzenesulfonamide (PubChem CID 6927654) has the molecular formula C17H21FN3O2S+ and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-fluoro-N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6927654 |
| Molecular Formula | C17H21FN3O2S+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 4-fluoro-N-[4-(4-methylpiperazin-4-ium-1-yl)phenyl]benzenesulfonamide |
| SMILES | C[NH+]1CCN(c2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C17H20FN3O2S/c1-20-10-12-21(13-11-20)16-6-4-15(5-7-16)19-24(22,23)17-8-2-14(18)3-9-17/h2-9,19H,10-13H2,1H3/p+1 |
| InChIKey | YWCAJJSOOGTLCC-UHFFFAOYSA-O |
| XLogP | 0.96 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|