C19H24FN3O3S — CID 110288174
4-fluoro-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]benzenesulfonamide (PubChem CID 110288174) has the molecular formula C19H24FN3O3S and a molecular weight of 393.48 g/mol. Its IUPAC name is 4-fluoro-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110288174 |
| Molecular Formula | C19H24FN3O3S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 4-fluoro-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]benzenesulfonamide |
| SMILES | COCCN1CCN(c2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)CC1 |
| InChI | InChI=1S/C19H24FN3O3S/c1-26-15-14-22-10-12-23(13-11-22)18-6-4-17(5-7-18)21-27(24,25)19-8-2-16(20)3-9-19/h2-9,21H,10-15H2,1H3 |
| InChIKey | KSFQGJWWBLXIIH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|