C21H28FN3O3S — CID 42635571
N-[4-[4-(4-fluorophenyl)piperazin-1-yl]butan-2-yl]-4-methoxybenzenesulfonamide (PubChem CID 42635571) has the molecular formula C21H28FN3O3S and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[4-[4-(4-fluorophenyl)piperazin-1-yl]butan-2-yl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[4-[4-(4-fluorophenyl)piperazin-1-yl]butan-2-yl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 42635571 |
| Molecular Formula | C21H28FN3O3S |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[4-[4-(4-fluorophenyl)piperazin-1-yl]butan-2-yl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(C)CCN2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H28FN3O3S/c1-17(23-29(26,27)21-9-7-20(28-2)8-10-21)11-12-24-13-15-25(16-14-24)19-5-3-18(22)4-6-19/h3-10,17,23H,11-16H2,1-2H3 |
| InChIKey | DYKKTQJWQWWKPU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |