C17H23N3O2S2 — CID 112502661
N-[4-(4-propylpiperazin-1-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 112502661) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-[4-(4-propylpiperazin-1-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-(4-propylpiperazin-1-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 112502661 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[4-(4-propylpiperazin-1-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | CCCN1CCN(c2ccc(NS(=O)(=O)c3cccs3)cc2)CC1 |
| InChI | InChI=1S/C17H23N3O2S2/c1-2-9-19-10-12-20(13-11-19)16-7-5-15(6-8-16)18-24(21,22)17-4-3-14-23-17/h3-8,14,18H,2,9-13H2,1H3 |
| InChIKey | VZDPGCQTFSGDDX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|