C17H22FN3O2S2 — CID 42389425
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]thiophene-2-sulfonamide (PubChem CID 42389425) has the molecular formula C17H22FN3O2S2 and a molecular weight of 383.51 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 42389425 |
| Molecular Formula | C17H22FN3O2S2 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCN1CCN(c2ccc(F)cc2)CC1)c1cccs1 |
| InChI | InChI=1S/C17H22FN3O2S2/c18-15-4-6-16(7-5-15)21-12-10-20(11-13-21)9-2-8-19-25(22,23)17-3-1-14-24-17/h1,3-7,14,19H,2,8-13H2 |
| InChIKey | RTALYCIVQXIXIJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|