C22H30FN3O3S — CID 42389503
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2-methoxy-4,5-dimethylbenzenesulfonamide (PubChem CID 42389503) has the molecular formula C22H30FN3O3S and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2-methoxy-4,5-dimethylbenzenesulfonamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2-methoxy-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 42389503 |
| Molecular Formula | C22H30FN3O3S |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-2-methoxy-4,5-dimethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)NCCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H30FN3O3S/c1-17-15-21(29-3)22(16-18(17)2)30(27,28)24-9-4-10-25-11-13-26(14-12-25)20-7-5-19(23)6-8-20/h5-8,15-16,24H,4,9-14H2,1-3H3 |
| InChIKey | TWYRGJRCYOSMBR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|