C20H25F2N3O3S — CID 42389269
2,5-difluoro-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]benzenesulfonamide (PubChem CID 42389269) has the molecular formula C20H25F2N3O3S and a molecular weight of 425.50 g/mol. Its IUPAC name is 2,5-difluoro-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42389269 |
| Molecular Formula | C20H25F2N3O3S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2,5-difluoro-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]benzenesulfonamide |
| SMILES | COc1ccc(N2CCN(CCCNS(=O)(=O)c3cc(F)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C20H25F2N3O3S/c1-28-18-6-4-17(5-7-18)25-13-11-24(12-14-25)10-2-9-23-29(26,27)20-15-16(21)3-8-19(20)22/h3-8,15,23H,2,9-14H2,1H3 |
| InChIKey | JJBGUUIRVCGFSR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|