C22H31N3O4S — CID 42267582
2-methoxy-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-4,5-dimethylbenzenesulfonamide (PubChem CID 42267582) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is 2-methoxy-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-4,5-dimethylbenzenesulfonamide.
| Compound Name | 2-methoxy-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 42267582 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-methoxy-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-4,5-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(N2CCN(CCNS(=O)(=O)c3cc(C)c(C)cc3OC)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O4S/c1-17-15-21(29-4)22(16-18(17)2)30(26,27)23-9-10-24-11-13-25(14-12-24)19-5-7-20(28-3)8-6-19/h5-8,15-16,23H,9-14H2,1-4H3 |
| InChIKey | WAYMCPVHOZJSFL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|