C25H37N3O3S — CID 42389281
N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 42389281) has the molecular formula C25H37N3O3S and a molecular weight of 459.66 g/mol. Its IUPAC name is N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 42389281 |
| Molecular Formula | C25H37N3O3S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | COc1ccc(N2CCN(CCCNS(=O)(=O)c3c(C)c(C)c(C)c(C)c3C)CC2)cc1 |
| InChI | InChI=1S/C25H37N3O3S/c1-18-19(2)21(4)25(22(5)20(18)3)32(29,30)26-12-7-13-27-14-16-28(17-15-27)23-8-10-24(31-6)11-9-23/h8-11,26H,7,12-17H2,1-6H3 |
| InChIKey | BTHHIXLJWHZPHU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|