C16H27N3O3S — CID 110445870
N-[3-(4-ethylpiperazin-1-yl)propyl]-4-methoxybenzenesulfonamide (PubChem CID 110445870) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110445870 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-4-methoxybenzenesulfonamide |
| SMILES | CCN1CCN(CCCNS(=O)(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C16H27N3O3S/c1-3-18-11-13-19(14-12-18)10-4-9-17-23(20,21)16-7-5-15(22-2)6-8-16/h5-8,17H,3-4,9-14H2,1-2H3 |
| InChIKey | NSFCADCYIFPNSX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|