C10H15NO3S2 — CID 15895607
4-methoxy-N-(3-sulfanylpropyl)benzenesulfonamide (PubChem CID 15895607) has the molecular formula C10H15NO3S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-methoxy-N-(3-sulfanylpropyl)benzenesulfonamide.
| Compound Name | 4-methoxy-N-(3-sulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 15895607 |
| Molecular Formula | C10H15NO3S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 4-methoxy-N-(3-sulfanylpropyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCS)cc1 |
| InChI | InChI=1S/C10H15NO3S2/c1-14-9-3-5-10(6-4-9)16(12,13)11-7-2-8-15/h3-6,11,15H,2,7-8H2,1H3 |
| InChIKey | ZNLCYJHSKAQMLC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|