C12H21ClN2O4S — CID 120717595
4-methoxy-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide;hydrochloride (PubChem CID 120717595) has the molecular formula C12H21ClN2O4S and a molecular weight of 324.83 g/mol. Its IUPAC name is 4-methoxy-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-methoxy-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717595 |
| Molecular Formula | C12H21ClN2O4S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 4-methoxy-N-[2-(2-methoxyethylamino)ethyl]benzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccc(OC)cc1.Cl |
| InChI | InChI=1S/C12H20N2O4S.ClH/c1-17-10-9-13-7-8-14-19(15,16)12-5-3-11(18-2)4-6-12;/h3-6,13-14H,7-10H2,1-2H3;1H |
| InChIKey | MOMMSWOFRLQAMQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|