C18H25ClN2O5S — CID 120717957
N-[2-(2-methoxyethylamino)ethyl]-4-(4-methoxyphenoxy)benzenesulfonamide;hydrochloride (PubChem CID 120717957) has the molecular formula C18H25ClN2O5S and a molecular weight of 416.93 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-4-(4-methoxyphenoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-4-(4-methoxyphenoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717957 |
| Molecular Formula | C18H25ClN2O5S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-4-(4-methoxyphenoxy)benzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccc(Oc2ccc(OC)cc2)cc1.Cl |
| InChI | InChI=1S/C18H24N2O5S.ClH/c1-23-14-13-19-11-12-20-26(21,22)18-9-7-17(8-10-18)25-16-5-3-15(24-2)4-6-16;/h3-10,19-20H,11-14H2,1-2H3;1H |
| InChIKey | VGHMNNGRGLWRKD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|