C15H27ClN2O3S — CID 120717422
N-[2-(2-methoxyethylamino)ethyl]-4-(2-methylpropyl)benzenesulfonamide;hydrochloride (PubChem CID 120717422) has the molecular formula C15H27ClN2O3S and a molecular weight of 350.91 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-4-(2-methylpropyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-4-(2-methylpropyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717422 |
| Molecular Formula | C15H27ClN2O3S |
| Molecular Weight | 350.91 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-4-(2-methylpropyl)benzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccc(CC(C)C)cc1.Cl |
| InChI | InChI=1S/C15H26N2O3S.ClH/c1-13(2)12-14-4-6-15(7-5-14)21(18,19)17-9-8-16-10-11-20-3;/h4-7,13,16-17H,8-12H2,1-3H3;1H |
| InChIKey | MXYOOAUYXXARTA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.91 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|