C15H25ClN2O3S — CID 120717803
N-[2-(2-methoxyethylamino)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;hydrochloride (PubChem CID 120717803) has the molecular formula C15H25ClN2O3S and a molecular weight of 348.90 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717803 |
| Molecular Formula | C15H25ClN2O3S |
| Molecular Weight | 348.90 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccc2c(c1)CCCC2.Cl |
| InChI | InChI=1S/C15H24N2O3S.ClH/c1-20-11-10-16-8-9-17-21(18,19)15-7-6-13-4-2-3-5-14(13)12-15;/h6-7,12,16-17H,2-5,8-11H2,1H3;1H |
| InChIKey | BIPGVZPMYHUDKV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.90 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|