C14H23ClN4O4S — CID 120717558
N-[2-(2-methoxyethylamino)ethyl]-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide;hydrochloride (PubChem CID 120717558) has the molecular formula C14H23ClN4O4S and a molecular weight of 378.88 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717558 |
| Molecular Formula | C14H23ClN4O4S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccc2c(c1)n(C)c(=O)n2C.Cl |
| InChI | InChI=1S/C14H22N4O4S.ClH/c1-17-12-5-4-11(10-13(12)18(2)14(17)19)23(20,21)16-7-6-15-8-9-22-3;/h4-5,10,15-16H,6-9H2,1-3H3;1H |
| InChIKey | IDVDSVIIZHOEFB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|