C11H21ClN4O5S — CID 120717981
N-[2-(2-methoxyethylamino)ethyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride (PubChem CID 120717981) has the molecular formula C11H21ClN4O5S and a molecular weight of 356.83 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717981 |
| Molecular Formula | C11H21ClN4O5S |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1cn(C)c(=O)n(C)c1=O.Cl |
| InChI | InChI=1S/C11H20N4O5S.ClH/c1-14-8-9(10(16)15(2)11(14)17)21(18,19)13-5-4-12-6-7-20-3;/h8,12-13H,4-7H2,1-3H3;1H |
| InChIKey | VWKTZTTXPMWIGS-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|