C12H21ClN2O3S2 — CID 120717757
N-[2-(2-methoxyethylamino)ethyl]-2-methylsulfanylbenzenesulfonamide;hydrochloride (PubChem CID 120717757) has the molecular formula C12H21ClN2O3S2 and a molecular weight of 340.90 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)ethyl]-2-methylsulfanylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(2-methoxyethylamino)ethyl]-2-methylsulfanylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717757 |
| Molecular Formula | C12H21ClN2O3S2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-[2-(2-methoxyethylamino)ethyl]-2-methylsulfanylbenzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccccc1SC.Cl |
| InChI | InChI=1S/C12H20N2O3S2.ClH/c1-17-10-9-13-7-8-14-19(15,16)12-6-4-3-5-11(12)18-2;/h3-6,13-14H,7-10H2,1-2H3;1H |
| InChIKey | HMUMULVENASDRS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|