C12H19ClF2N2O3S — CID 120717697
2,4-difluoro-N-[2-(2-methoxyethylamino)ethyl]-5-methylbenzenesulfonamide;hydrochloride (PubChem CID 120717697) has the molecular formula C12H19ClF2N2O3S and a molecular weight of 344.81 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-(2-methoxyethylamino)ethyl]-5-methylbenzenesulfonamide;hydrochloride.
| Compound Name | 2,4-difluoro-N-[2-(2-methoxyethylamino)ethyl]-5-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717697 |
| Molecular Formula | C12H19ClF2N2O3S |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2,4-difluoro-N-[2-(2-methoxyethylamino)ethyl]-5-methylbenzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1cc(C)c(F)cc1F.Cl |
| InChI | InChI=1S/C12H18F2N2O3S.ClH/c1-9-7-12(11(14)8-10(9)13)20(17,18)16-4-3-15-5-6-19-2;/h7-8,15-16H,3-6H2,1-2H3;1H |
| InChIKey | SYSZEFLUPBCNEK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|