C16H29ClN2O4S — CID 120717841
4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methyl-5-propan-2-ylbenzenesulfonamide;hydrochloride (PubChem CID 120717841) has the molecular formula C16H29ClN2O4S and a molecular weight of 380.94 g/mol. Its IUPAC name is 4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methyl-5-propan-2-ylbenzenesulfonamide;hydrochloride.
| Compound Name | 4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methyl-5-propan-2-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717841 |
| Molecular Formula | C16H29ClN2O4S |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2-methyl-5-propan-2-ylbenzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1cc(C(C)C)c(OC)cc1C.Cl |
| InChI | InChI=1S/C16H28N2O4S.ClH/c1-12(2)14-11-16(13(3)10-15(14)22-5)23(19,20)18-7-6-17-8-9-21-4;/h10-12,17-18H,6-9H2,1-5H3;1H |
| InChIKey | DZHJUOQYVCXVTH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|