C14H25ClN2O4S — CID 120717823
4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2,5-dimethylbenzenesulfonamide;hydrochloride (PubChem CID 120717823) has the molecular formula C14H25ClN2O4S and a molecular weight of 352.88 g/mol. Its IUPAC name is 4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2,5-dimethylbenzenesulfonamide;hydrochloride.
| Compound Name | 4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2,5-dimethylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717823 |
| Molecular Formula | C14H25ClN2O4S |
| Molecular Weight | 352.88 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 4-methoxy-N-[2-(2-methoxyethylamino)ethyl]-2,5-dimethylbenzenesulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1cc(C)c(OC)cc1C.Cl |
| InChI | InChI=1S/C14H24N2O4S.ClH/c1-11-10-14(12(2)9-13(11)20-4)21(17,18)16-6-5-15-7-8-19-3;/h9-10,15-16H,5-8H2,1-4H3;1H |
| InChIKey | HIPFRPJULBPOLX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.88 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|